55645-40-4 Usage
Description
Erythro-N-benzyl-3-(benzylamino)aspartic acid is a unique aspartic acid derivative featuring a benzyl group and a benzylamino group attached to the nitrogen atom. It is a member of the amino acid derivatives class and is characterized by its distinct molecular structure and functional groups. This chemical compound is utilized in the fields of organic chemistry and drug development research, offering potential applications in the synthesis of peptides and pharmaceuticals.
Uses
Used in Organic Chemistry:
Erythro-N-benzyl-3-(benzylamino)aspartic acid is used as a building block in organic chemistry for the synthesis of complex organic molecules. Its unique structure and functional groups facilitate the creation of novel compounds with specific properties.
Used in Drug Development Research:
In the pharmaceutical industry, erythro-N-benzyl-3-(benzylamino)aspartic acid is employed as a key component in drug development research. Its distinct molecular structure and properties make it a valuable tool for the study and development of new therapeutic agents.
Used in Peptide Synthesis:
Erythro-N-benzyl-3-(benzylamino)aspartic acid is used as a monomer in peptide synthesis, contributing to the formation of bioactive peptides with potential applications in medicine and biotechnology.
Used in Pharmaceutical Synthesis:
erythro-N-benzyl-3-(benzylamino)aspartic acid is utilized as a starting material or intermediate in the synthesis of pharmaceuticals, particularly those targeting specific biological pathways or receptors. Its unique structure allows for the development of drugs with improved efficacy and selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 55645-40-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,6,4 and 5 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 55645-40:
(7*5)+(6*5)+(5*6)+(4*4)+(3*5)+(2*4)+(1*0)=134
134 % 10 = 4
So 55645-40-4 is a valid CAS Registry Number.
InChI:InChI=1/C18H20N2O4/c21-17(22)15(19-11-13-7-3-1-4-8-13)16(18(23)24)20-12-14-9-5-2-6-10-14/h1-10,15-16,19-20H,11-12H2,(H,21,22)(H,23,24)
55645-40-4Relevant articles and documents
CROSS-LINKED PYRROLOBENZODIAZEPINE DIMER (PBD) DERIVATIVE AND ITS CONJUGATES
-
Page/Page column 162, (2020/01/31)
A novel cross-linked cytotoxic agents, pyrrolobenzo-diazepine dimer (PBD) derivatives, and their conjugates to a cell-binding molecule, a method for preparation of the conjugates and the therapeutic use of the conjugates.
Method of treating DBA mother liquor
-
Paragraph 0048; 0059-0185, (2020/04/02)
The present invention relates to a method of treating a DBA mother liquor, wherein a small amount of a reagent is used, high DBA yield is provided, and waste is less.